ChemNet > CAS > 589-82-2 3-Heptanol
589-82-2 3-Heptanol
| 상품명칭 |
3-Heptanol |
| 별명 |
heptan-3-ol; (3R)-heptan-3-ol; (3S)-heptan-3-ol |
| 분자식 |
C7H16O |
| 분자량 |
116.2013 |
| InChI |
InChI=1/C7H16O/c1-3-5-6-7(8)4-2/h7-8H,3-6H2,1-2H3/t7-/m0/s1 |
| cas번호 |
589-82-2 |
| EC번호 |
209-661-1 |
| 분자 구조 |
|
| 밀도 |
0.818g/cm3 |
| 녹는 점 |
-70℃ |
| 비등점 |
156.7°C at 760 mmHg |
| 굴절 지수 |
1.42 |
| 인화점 |
54.4°C |
| 위험성 표시 |
 Xn:Harmful;
|
| 리스크 규칙 |
R22:Harmful if swallowed.;
R36:Irritating to eyes.;
|
| 보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|
