ChemNet > CAS > 589-91-3 4-Methylcyclohexanol, mixture of cis and trans
589-91-3 4-Methylcyclohexanol, mixture of cis and trans
상품명칭 |
4-Methylcyclohexanol, mixture of cis and trans |
별명 |
4-Methylcyclohexanol (cis+trans); 4-Methylcyclohexanol; trans-4-methylcyclohexanol; Methyl cyclohexanol |
분자식 |
C7H14O |
분자량 |
114.1855 |
InChI |
InChI=1/C7H14O/c1-6-2-4-7(8)5-3-6/h6-8H,2-5H2,1H3/t6-,7- |
cas번호 |
589-91-3 |
EC번호 |
209-664-8 |
분자 구조 |
|
밀도 |
0.925g/cm3 |
녹는 점 |
-41℃ |
비등점 |
170.322°C at 760 mmHg |
굴절 지수 |
1.463 |
인화점 |
70°C |
물 용해도 |
slightly soluble |
위험성 표시 |
|
리스크 규칙 |
|
보안 규칙 |
S24/25:;
|
|