ChemNet > CAS > 591-08-2 N-Acetylthiourea
591-08-2 N-Acetylthiourea
상품명칭 |
N-Acetylthiourea |
별명 |
N-Acetylthiourea,98%; N-carbamothioylacetamide |
분자식 |
C3H6N2OS |
분자량 |
118.1575 |
InChI |
InChI=1/C3H6N2OS/c1-2(6)5-3(4)7/h1H3,(H3,4,5,6,7) |
cas번호 |
591-08-2 |
EC번호 |
209-699-9 |
분자 구조 |
|
밀도 |
1.275g/cm3 |
녹는 점 |
166-168℃ |
비등점 |
208.6°C at 760 mmHg |
굴절 지수 |
1.569 |
인화점 |
80°C |
위험성 표시 |
T:Toxic;
|
리스크 규칙 |
R23/24/25:Toxic by inhalation, in contact with skin and if swallowed.;
|
보안 규칙 |
S23:Do not inhale gas/fumes/vapour/spray.;
S24/25:Avoid contact with skin and eyes.;
|
|