ChemNet > CAS > 596-09-8 Fluorescein diacetate
596-09-8 Fluorescein diacetate
상품명칭 |
Fluorescein diacetate |
별명 |
Diacetylfluorescein; Fluorescein Diacetat; 3-oxo-3H-spiro[2-benzofuran-1,9'-xanthene]-3',6'-diyl diacetate |
분자식 |
C24H16O7 |
분자량 |
416.3796 |
InChI |
InChI=1/C24H16O7/c1-13(25)28-15-7-9-19-21(11-15)30-22-12-16(29-14(2)26)8-10-20(22)24(19)18-6-4-3-5-17(18)23(27)31-24/h3-12H,1-2H3 |
cas번호 |
596-09-8 |
EC번호 |
209-877-6 |
분자 구조 |
|
밀도 |
1.47g/cm3 |
녹는 점 |
206-208℃ |
비등점 |
604.7°C at 760 mmHg |
굴절 지수 |
1.681 |
인화점 |
264°C |
위험성 표시 |
|
리스크 규칙 |
|
보안 규칙 |
S24/25:Avoid contact with skin and eyes.;
|
|