ChemNet > CAS > 5961-55-7 4-Methoxy-1-naphthonitrile
5961-55-7 4-Methoxy-1-naphthonitrile
상품명칭 |
4-Methoxy-1-naphthonitrile |
별명 |
1-Cyano-4-methoxynaphtalene; 1-Cyano-4-methoxynaphthalene; 4-methoxynaphthalene-1-carbonitrile |
분자식 |
C12H9NO |
분자량 |
183.206 |
InChI |
InChI=1/C12H9NO/c1-14-12-7-6-9(8-13)10-4-2-3-5-11(10)12/h2-7H,1H3 |
cas번호 |
5961-55-7 |
EC번호 |
227-734-6 |
분자 구조 |
|
밀도 |
1.16g/cm3 |
녹는 점 |
99-102℃ |
비등점 |
364.6°C at 760 mmHg |
굴절 지수 |
1.622 |
인화점 |
153.7°C |
위험성 표시 |
Xn:Harmful;
|
리스크 규칙 |
R20/21:Harmful by inhalation and in contact with skin.;
|
보안 규칙 |
S23:Do not inhale gas/fumes/vapour/spray.;
|
|