ChemNet > CAS > 598-38-9 2,2-dichloroethanol
598-38-9 2,2-dichloroethanol
| 상품명칭 |
2,2-dichloroethanol |
| 별명 |
2,2-Dichloroethanol; 4-01-00-01383 (Beilstein Handbook Reference); BRN 1731633; Dichloroethanol; NSC 60513; Ethanol, 2,2-dichloro- |
| 분자식 |
C2H4Cl2O |
| 분자량 |
114.9586 |
| InChI |
InChI=1/C2H4Cl2O/c3-2(4)1-5/h2,5H,1H2 |
| cas번호 |
598-38-9 |
| EC번호 |
209-931-9 |
| 분자 구조 |
|
| 밀도 |
1.398g/cm3 |
| 비등점 |
146°C at 760 mmHg |
| 굴절 지수 |
1.459 |
| 인화점 |
78.3°C |
| 위험성 표시 |
|
| 리스크 규칙 |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
R40:Possible risks of irreversible effects.;
|
| 보안 규칙 |
S23:Do not inhale gas/fumes/vapour/spray.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
|
|
