ChemNet > CAS > 59918-68-2 3-furancarbothioamide
59918-68-2 3-furancarbothioamide
| 상품명칭 |
3-furancarbothioamide |
| 별명 |
furan-3-carbothioamide |
| 분자식 |
C5H5NOS |
| 분자량 |
127.1643 |
| InChI |
InChI=1/C5H5NOS/c6-5(8)4-1-2-7-3-4/h1-3H,(H2,6,8) |
| cas번호 |
59918-68-2 |
| 분자 구조 |
|
| 밀도 |
1.287g/cm3 |
| 녹는 점 |
74℃ |
| 비등점 |
219.6°C at 760 mmHg |
| 굴절 지수 |
1.62 |
| 인화점 |
86.6°C |
| 위험성 표시 |
 Xn:Harmful;
|
| 리스크 규칙 |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| 보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
|
|
