ChemNet > CAS > 602-00-6 3-Hydroxy-2-nitrobenzoic acid
602-00-6 3-Hydroxy-2-nitrobenzoic acid
상품명칭 |
3-Hydroxy-2-nitrobenzoic acid |
분자식 |
C7H5NO5 |
분자량 |
183.1183 |
InChI |
InChI=1/C7H5NO5/c9-5-3-1-2-4(7(10)11)6(5)8(12)13/h1-3,9H,(H,10,11) |
cas번호 |
602-00-6 |
분자 구조 |
|
밀도 |
1.631g/cm3 |
비등점 |
362.9°C at 760 mmHg |
굴절 지수 |
1.663 |
인화점 |
166.7°C |
위험성 표시 |
|
리스크 규칙 |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|