ChemNet > CAS > 602-60-8 9-nitroanthracene
602-60-8 9-nitroanthracene
상품명칭 |
9-nitroanthracene |
별명 |
9-Nitroanthracene (purity); 1-nitroanthracene |
분자식 |
C14H9NO2 |
분자량 |
223.2268 |
InChI |
InChI=1/C14H9NO2/c16-15(17)14-7-3-6-12-8-10-4-1-2-5-11(10)9-13(12)14/h1-9H |
cas번호 |
602-60-8 |
EC번호 |
210-021-9 |
분자 구조 |
|
밀도 |
1.316g/cm3 |
녹는 점 |
144-144℃ |
비등점 |
413.3°C at 760 mmHg |
굴절 지수 |
1.741 |
인화점 |
207.5°C |
위험성 표시 |
|
리스크 규칙 |
|
보안 규칙 |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|