ChemNet > CAS > 605-69-6 Martius Yellow
605-69-6 Martius Yellow
| 상품명칭 |
Martius Yellow |
| 별명 |
C.I. 10315; Martius yellow; 2,4-Dinitro-1-naphthol; Acid Yellow 24; C.I. 10315~Martius Yellow; 2,4-dinitronaphthalen-1-ol; 2,4-dinitronaphthalen-1-olate |
| 분자식 |
C10H5N2O5 |
| 분자량 |
233.1576 |
| InChI |
InChI=1/C10H6N2O5/c13-10-7-4-2-1-3-6(7)8(11(14)15)5-9(10)12(16)17/h1-5,13H/p-1 |
| cas번호 |
605-69-6 |
| EC번호 |
210-093-1 |
| 분자 구조 |
|
| 녹는 점 |
130-133℃ |
| 비등점 |
407.9°C at 760 mmHg |
| 인화점 |
179.9°C |
| 위험성 표시 |
 T:Toxic;
|
| 리스크 규칙 |
R23/24/25:Toxic by inhalation, in contact with skin and if swallowed.;
|
| 보안 규칙 |
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|
