ChemNet > CAS > 608-08-2 Indoxyl acetate
608-08-2 Indoxyl acetate
상품명칭 |
Indoxyl acetate |
별명 |
3-Acetoxyindole~Indolyl acetate~Y-acetate; Indoxyl acetate 3-Indoxyl acetate; 3-Indolyl acetate; 3-Acetoxyindole; 1H-indol-3-yl acetate |
분자식 |
C10H9NO2 |
분자량 |
175.184 |
InChI |
InChI=1/C10H9NO2/c1-7(12)13-10-6-11-9-5-3-2-4-8(9)10/h2-6,11H,1H3 |
cas번호 |
608-08-2 |
EC번호 |
210-154-2 |
분자 구조 |
|
밀도 |
1.255g/cm3 |
녹는 점 |
128-131℃ |
비등점 |
339.1°C at 760 mmHg |
굴절 지수 |
1.633 |
인화점 |
158.9°C |
위험성 표시 |
|
리스크 규칙 |
|
보안 규칙 |
S24/25:Avoid contact with skin and eyes.;
|
|