ChemNet > CAS > 609-11-0 Ethyl 2,3-dibromobutyrate
609-11-0 Ethyl 2,3-dibromobutyrate
상품명칭 |
Ethyl 2,3-dibromobutyrate |
별명 |
2,3-Dibromobutyric acid ethyl ester; 2,3-Dibromo-n-butyric acid ethyl ester; ethyl 2,3-dibromobutanoate |
분자식 |
C6H10Br2O2 |
분자량 |
273.9504 |
InChI |
InChI=1/C6H10Br2O2/c1-3-10-6(9)5(8)4(2)7/h4-5H,3H2,1-2H3 |
cas번호 |
609-11-0 |
EC번호 |
210-177-8 |
분자 구조 |
|
밀도 |
1.731g/cm3 |
비등점 |
226.7°C at 760 mmHg |
굴절 지수 |
1.506 |
인화점 |
90.9°C |
위험성 표시 |
|
리스크 규칙 |
R34:Causes burns.;
|
보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|