ChemNet > CAS > 613-03-6 1,2,4-Triacetoxybenzene
613-03-6 1,2,4-Triacetoxybenzene
상품명칭 |
1,2,4-Triacetoxybenzene |
별명 |
1,2,4-Phenenyl triacetate; benzene-1,2,4-triyl triacetate; 2-[(1-hydroxyethenyl)oxy]benzene-1,4-diyl diacetate |
분자식 |
C12H12O6 |
분자량 |
252.2201 |
InChI |
InChI=1/C12H12O6/c1-7(13)16-10-4-5-11(17-8(2)14)12(6-10)18-9(3)15/h4-6,15H,3H2,1-2H3 |
cas번호 |
613-03-6 |
EC번호 |
210-327-2 |
분자 구조 |
|
밀도 |
1.276g/cm3 |
녹는 점 |
98-100℃ |
비등점 |
401°C at 760 mmHg |
굴절 지수 |
1.533 |
인화점 |
153.2°C |
위험성 표시 |
|
리스크 규칙 |
|
보안 규칙 |
S24/25:Avoid contact with skin and eyes.;
|
|