ChemNet > CAS > 613-13-8 2-Aminoanthracene
613-13-8 2-Aminoanthracene
상품명칭 |
2-Aminoanthracene |
별명 |
2-anthramine practical grade*crystalline; 2-anthrylamine
; 2-Anthramine; 2-Anthranamine; anthracen-2-amine |
분자식 |
C14H11N |
분자량 |
193.2438 |
InChI |
InChI=1/C14H11N/c15-14-6-5-12-7-10-3-1-2-4-11(10)8-13(12)9-14/h1-9H,15H2 |
cas번호 |
613-13-8 |
EC번호 |
210-330-9 |
분자 구조 |
|
밀도 |
1.208g/cm3 |
녹는 점 |
238-241℃ |
비등점 |
414.2°C at 760 mmHg |
굴절 지수 |
1.765 |
인화점 |
229°C |
위험성 표시 |
Xn:Harmful;
|
리스크 규칙 |
R33:Danger of cummulative effects.;
|
보안 규칙 |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|