ChemNet > CAS > 614-57-3 Cinnamylideneacetophenone
614-57-3 Cinnamylideneacetophenone
| 상품명칭 |
Cinnamylideneacetophenone |
| 별명 |
5-phenylpenta-2,4-dienophenone; 1,5-Diphenyl-2,4-pentadien-1-one~5-Phenyl-2,4-pentadienophenone; 1,5-diphenylpenta-2,4-dien-1-one; (2E,4E)-1,5-diphenylpenta-2,4-dien-1-one |
| 분자식 |
C17H14O |
| 분자량 |
234.2925 |
| InChI |
InChI=1/C17H14O/c18-17(16-12-5-2-6-13-16)14-8-7-11-15-9-3-1-4-10-15/h1-14H/b11-7+,14-8+ |
| cas번호 |
614-57-3 |
| EC번호 |
210-385-9 |
| 분자 구조 |
|
| 밀도 |
1.082g/cm3 |
| 녹는 점 |
100-102℃ |
| 비등점 |
388.1°C at 760 mmHg |
| 굴절 지수 |
1.624 |
| 인화점 |
169.6°C |
| 위험성 표시 |
|
| 리스크 규칙 |
|
| 보안 규칙 |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|
