ChemNet > CAS > 6174-86-3 3-chloro-4-methyl-7-hydroxycoumarin
6174-86-3 3-chloro-4-methyl-7-hydroxycoumarin
| 상품명칭 |
3-chloro-4-methyl-7-hydroxycoumarin |
| 별명 |
3-Chloro-4-methylumbelliferone; 3-Chloro-7-hydroxy-4-methylcoumarin; 3-chloro-7-hydroxy-4-methyl-2H-chromen-2-one |
| 분자식 |
C10H7ClO3 |
| 분자량 |
210.6138 |
| InChI |
InChI=1/C10H7ClO3/c1-5-7-3-2-6(12)4-8(7)14-10(13)9(5)11/h2-4,12H,1H3 |
| cas번호 |
6174-86-3 |
| EC번호 |
228-217-8 |
| 분자 구조 |
|
| 밀도 |
1.48g/cm3 |
| 비등점 |
405.8°C at 760 mmHg |
| 굴절 지수 |
1.637 |
| 인화점 |
199.2°C |
| 위험성 표시 |
|
| 리스크 규칙 |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| 보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
