ChemNet > CAS > 619-31-8 N,N-Dimethyl-3-nitroaniline
619-31-8 N,N-Dimethyl-3-nitroaniline
상품명칭 |
N,N-Dimethyl-3-nitroaniline |
별명 |
3-Nitro-N,N-dimethylaniline; Benzenamine, N,N-dimethyl-3-nitro- |
분자식 |
C8H10N2O2 |
분자량 |
166.1772 |
InChI |
InChI=1/C8H10N2O2/c1-9(2)7-4-3-5-8(6-7)10(11)12/h3-6H,1-2H3 |
cas번호 |
619-31-8 |
EC번호 |
210-590-3 |
분자 구조 |
|
밀도 |
1.193g/cm3 |
녹는 점 |
57-61℃ |
비등점 |
282.5°C at 760 mmHg |
굴절 지수 |
1.591 |
인화점 |
117°C |
위험성 표시 |
|
리스크 규칙 |
|
보안 규칙 |
S24/25:Avoid contact with skin and eyes.;
|
|