ChemNet > CAS > 622-51-5 p-Tolylurea
622-51-5 p-Tolylurea
| 상품명칭 |
p-Tolylurea |
| 별명 |
4-Methylphenylurea; 1-(4-methylphenyl)urea |
| 분자식 |
C8H10N2O |
| 분자량 |
150.1778 |
| InChI |
InChI=1/C8H10N2O/c1-6-2-4-7(5-3-6)10-8(9)11/h2-5H,1H3,(H3,9,10,11) |
| cas번호 |
622-51-5 |
| EC번호 |
210-739-2 |
| 분자 구조 |
|
| 밀도 |
1.192g/cm3 |
| 녹는 점 |
180-182℃ |
| 비등점 |
255.1°C at 760 mmHg |
| 굴절 지수 |
1.62 |
| 인화점 |
108.1°C |
| 위험성 표시 |
|
| 리스크 규칙 |
|
| 보안 규칙 |
S24/25:Avoid contact with skin and eyes.;
|
|
