ChemNet > CAS > 622-52-6 P-Tolylthiourea
622-52-6 P-Tolylthiourea
상품명칭 |
P-Tolylthiourea |
별명 |
4-Methylphenylthiourea; para-Tolylthiourea;
; 1-(4-methylphenyl)thiourea |
분자식 |
C8H10N2S |
분자량 |
166.2434 |
InChI |
InChI=1/C8H10N2S/c1-6-2-4-7(5-3-6)10-8(9)11/h2-5H,1H3,(H3,9,10,11) |
cas번호 |
622-52-6 |
EC번호 |
210-740-8 |
분자 구조 |
|
밀도 |
1.242g/cm3 |
비등점 |
282.5°C at 760 mmHg |
굴절 지수 |
1.696 |
인화점 |
124.6°C |
위험성 표시 |
|
리스크 규칙 |
R25:Toxic if swallowed.;
|
보안 규칙 |
S22:Do not inhale dust.;
S36/37:Wear suitable protective clothing and gloves.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|