ChemNet > CAS > 623-37-0 3-Hexanol
623-37-0 3-Hexanol
| 상품명칭 |
3-Hexanol |
| 별명 |
3-Hexyl alcohol; Ethyl propyl carbinol; FEMA No. 3351; NSC 60708; hexan-3-ol; (3S)-hexan-3-ol; (3R)-hexan-3-ol |
| 분자식 |
C6H14O |
| 분자량 |
102.1748 |
| InChI |
InChI=1/C6H14O/c1-3-5-6(7)4-2/h6-7H,3-5H2,1-2H3/t6-/m1/s1 |
| cas번호 |
623-37-0 |
| EC번호 |
210-790-0 |
| 분자 구조 |
|
| 밀도 |
0.814g/cm3 |
| 비등점 |
135°C at 760 mmHg |
| 굴절 지수 |
1.413 |
| 인화점 |
41.7°C |
| 위험성 표시 |
 Xn:Harmful;
|
| 리스크 규칙 |
R10:Flammable.;
R22:Harmful if swallowed.;
|
| 보안 규칙 |
S16:Keep away from sources of ignition - No smoking.;
S24/25:Avoid contact with skin and eyes.;
|
|
