ChemNet > CAS > 623-76-7 1,3-diethylurea
623-76-7 1,3-diethylurea
상품명칭 |
1,3-diethylurea |
별명 |
N,N-Diethylurea; Diethylurea symmetrical; N,N'-Diethylurea |
분자식 |
C5H12N2O |
분자량 |
116.1616 |
InChI |
InChI=1/C5H12N2O/c1-3-6-5(8)7-4-2/h3-4H2,1-2H3,(H2,6,7,8) |
cas번호 |
623-76-7 |
EC번호 |
210-811-3 |
분자 구조 |
|
밀도 |
0.923g/cm3 |
녹는 점 |
112-113℃ |
비등점 |
263°C at 760 mmHg |
굴절 지수 |
1.428 |
인화점 |
121.1°C |
위험성 표시 |
|
리스크 규칙 |
|
보안 규칙 |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|