ChemNet > CAS > 624-39-5 1,4-Benzenedithiol
624-39-5 1,4-Benzenedithiol
| 상품명칭 |
1,4-Benzenedithiol |
| 별명 |
1,4-Dimercaptobenzene; Dithiohydroquinone; benzene-1,4-dithiol; benzene-1,4-bis(thiolate) |
| 분자식 |
C6H4S2 |
| 분자량 |
140.2271 |
| InChI |
InChI=1/C6H6S2/c7-5-1-2-6(8)4-3-5/h1-4,7-8H/p-2 |
| cas번호 |
624-39-5 |
| 분자 구조 |
|
| 비등점 |
243.3°C at 760 mmHg |
| 인화점 |
111.8°C |
| 위험성 표시 |
|
| 리스크 규칙 |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
R36/38:Irritating to eyes and skin.;
|
| 보안 규칙 |
S22:Do not inhale dust.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
|
|
