ChemNet > CAS > 62476-62-4 Alpha,Alpha,2-Trichloro-6-fluorotoluene
62476-62-4 Alpha,Alpha,2-Trichloro-6-fluorotoluene
상품명칭 |
Alpha,Alpha,2-Trichloro-6-fluorotoluene |
별명 |
2-Chloro-6-fluorobenzalchloride; 1-chloro-2-(dichloromethyl)-3-fluorobenzene |
분자식 |
C7H4Cl3F |
분자량 |
213.4641 |
InChI |
InChI=1/C7H4Cl3F/c8-4-2-1-3-5(11)6(4)7(9)10/h1-3,7H |
cas번호 |
62476-62-4 |
EC번호 |
263-562-8 |
분자 구조 |
|
밀도 |
1.467g/cm3 |
비등점 |
225.4°C at 760 mmHg |
굴절 지수 |
1.541 |
인화점 |
99.7°C |
위험성 표시 |
Xi:Irritant;
|
리스크 규칙 |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
보안 규칙 |
S24/25:Avoid contact with skin and eyes.;
|
|