ChemNet > CAS > 625-48-9 2-Nitroethanol
625-48-9 2-Nitroethanol
상품명칭 |
2-Nitroethanol |
별명 |
1-nitro-2-hydroxyethane; 2-Nitroethanol, 85% (Assay); beta-nitroalcohol; beta-nitroethyl alcohol; nitroethanol; |
분자식 |
C2H5NO3 |
분자량 |
91.07 |
InChI |
InChI=1/C2H5NO3/c4-2-1-3(5)6/h4H,1-2H2 |
cas번호 |
625-48-9 |
EC번호 |
210-895-1 |
분자 구조 |
|
밀도 |
1.267g/cm3 |
비등점 |
193.8°C at 760 mmHg |
굴절 지수 |
1.438 |
인화점 |
113.8°C |
위험성 표시 |
|
리스크 규칙 |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|