ChemNet > CAS > 6298-72-2 1,4-bis(chloromethyl)-2,5-dimethylbenzene
6298-72-2 1,4-bis(chloromethyl)-2,5-dimethylbenzene
| 상품명칭 |
1,4-bis(chloromethyl)-2,5-dimethylbenzene |
| 별명 |
1,4-Bis(chloromethyl)-2,5-dimethylbenzene; 2,5-Di(Chloromethyl)-p-xylene; benzene, 1,4-bis(chloromethyl)-2,5-dimethyl- |
| 분자식 |
C10H12Cl2 |
| 분자량 |
203.1083 |
| InChI |
InChI=1/C10H12Cl2/c1-7-3-10(6-12)8(2)4-9(7)5-11/h3-4H,5-6H2,1-2H3 |
| cas번호 |
6298-72-2 |
| EC번호 |
228-575-5 |
| 분자 구조 |
|
| 밀도 |
1.145g/cm3 |
| 녹는 점 |
131.5-132.5℃ |
| 비등점 |
291.5°C at 760 mmHg |
| 굴절 지수 |
1.537 |
| 인화점 |
142.2°C |
| 위험성 표시 |
|
| 리스크 규칙 |
R34:Causes burns.;
|
| 보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|
