ChemNet > CAS > 6319-96-6 N-chloroacetylglycine
6319-96-6 N-chloroacetylglycine
| 상품명칭 |
N-chloroacetylglycine |
| 별명 |
Chloroac-Gly-OH; Chloroacetylglycine; N-(Chloroacetyl)glycine; N-Chloroacetyl glycine |
| 분자식 |
C4H6ClNO3 |
| 분자량 |
151.5483 |
| InChI |
InChI=1/C4H6ClNO3/c5-1-3(7)6-2-4(8)9/h1-2H2,(H,6,7)(H,8,9) |
| cas번호 |
6319-96-6 |
| 분자 구조 |
|
| 밀도 |
1.422g/cm3 |
| 비등점 |
431.6°C at 760 mmHg |
| 굴절 지수 |
1.486 |
| 인화점 |
214.8°C |
| 위험성 표시 |
|
| 리스크 규칙 |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| 보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
