ChemNet > CAS > 632-22-4 1,1,3,3-Tetramethylurea
632-22-4 1,1,3,3-Tetramethylurea
| 상품명칭 |
1,1,3,3-Tetramethylurea |
| 별명 |
Tetramethylurea |
| 분자식 |
C5H12N2O |
| 분자량 |
116.16 |
| InChI |
InChI=1/C5H12N2O/c1-6(2)5(8)7(3)4/h1-4H3 |
| cas번호 |
632-22-4 |
| EC번호 |
211-173-9 |
| 분자 구조 |
|
| 밀도 |
0.9879 |
| 녹는 점 |
-1℃ |
| 비등점 |
174-178℃ |
| 굴절 지수 |
1.4496-1.4516 |
| 인화점 |
65℃ |
| 물 용해도 |
miscible |
| 위험성 표시 |
 Xn:Harmful;
|
| 리스크 규칙 |
R22:;
|
| 보안 규칙 |
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
S53:Avoid exposure - obtain special instructions before use.;
|
|
