ChemNet > CAS > 6320-15-6 6-Chloro-2,4-dimethixypyrimidine
6320-15-6 6-Chloro-2,4-dimethixypyrimidine
상품명칭 |
6-Chloro-2,4-dimethixypyrimidine |
별명 |
6-Chloro-2,4-dimethoxypyrimidine; 4-chloro-2,6-dimethoxypyrimidine |
분자식 |
C6H7ClN2O2 |
분자량 |
174.585 |
InChI |
InChI=1/C6H7ClN2O2/c1-10-5-3-4(7)8-6(9-5)11-2/h3H,1-2H3 |
cas번호 |
6320-15-6 |
EC번호 |
228-669-6 |
분자 구조 |
|
밀도 |
1.285g/cm3 |
녹는 점 |
74-76℃ |
비등점 |
280.6°C at 760 mmHg |
굴절 지수 |
1.51 |
인화점 |
123.5°C |
위험성 표시 |
|
리스크 규칙 |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|