ChemNet > CAS > 6326-44-9 Diethyl formamidomalonate
6326-44-9 Diethyl formamidomalonate
상품명칭 |
Diethyl formamidomalonate |
별명 |
Formamidomalonic acid diethyl ester; diethyl (formylamino)propanedioate; Diethylformamidomalonate |
분자식 |
C8H13NO5 |
분자량 |
203.1925 |
InChI |
InChI=1/C8H13NO5/c1-3-13-7(11)6(9-5-10)8(12)14-4-2/h5-6H,3-4H2,1-2H3,(H,9,10) |
cas번호 |
6326-44-9 |
EC번호 |
228-692-1 |
분자 구조 |
|
밀도 |
1.167g/cm3 |
녹는 점 |
51-56℃ |
비등점 |
316.8°C at 760 mmHg |
굴절 지수 |
1.445 |
인화점 |
165.7°C |
위험성 표시 |
|
리스크 규칙 |
|
보안 규칙 |
S24/25:Avoid contact with skin and eyes.;
|
|