ChemNet > CAS > 636-26-0 5-methyl-2-thiouracil
636-26-0 5-methyl-2-thiouracil
상품명칭 |
5-methyl-2-thiouracil |
별명 |
4-Hydroxy-2-mercapto-5-methylpyrimidine; 2-Thiothymine; 5-methyl-2-thioxo-2,3-dihydropyrimidin-4(1H)-one |
분자식 |
C5H6N2OS |
분자량 |
142.1789 |
InChI |
InChI=1/C5H6N2OS/c1-3-2-6-5(9)7-4(3)8/h2H,1H3,(H2,6,7,8,9) |
cas번호 |
636-26-0 |
분자 구조 |
|
밀도 |
1.36g/cm3 |
녹는 점 |
265-267℃ |
비등점 |
329.7°C at 760 mmHg |
굴절 지수 |
1.638 |
인화점 |
153.2°C |
위험성 표시 |
|
리스크 규칙 |
R22:Harmful if swallowed.;
R40:Possible risks of irreversible effects.;
|
보안 규칙 |
S22:Do not inhale dust.;
S36/37:Wear suitable protective clothing and gloves.;
|
|