ChemNet > CAS > 64-65-3 Bemegride
64-65-3 Bemegride
| 상품명칭 |
Bemegride |
| 별명 |
3-Ethyl-3-methylglutarimide; 4-Ethyl-4-methyl-2,6-piperidinedione; 3-Methyl-3-ethylglutarimide; 4-ethyl-4-methylpiperidine-2,6-dione |
| 분자식 |
C8H13NO2 |
| 분자량 |
155.1943 |
| InChI |
InChI=1/C8H13NO2/c1-3-8(2)4-6(10)9-7(11)5-8/h3-5H2,1-2H3,(H,9,10,11) |
| cas번호 |
64-65-3 |
| EC번호 |
200-588-0 |
| 분자 구조 |
|
| 밀도 |
1.024g/cm3 |
| 녹는 점 |
126-129℃ |
| 비등점 |
282°C at 760 mmHg |
| 굴절 지수 |
1.448 |
| 인화점 |
125.8°C |
| 위험성 표시 |
 T:Toxic;
|
| 리스크 규칙 |
R23/24/25:Toxic by inhalation, in contact with skin and if swallowed.;
|
| 보안 규칙 |
S24/25:Avoid contact with skin and eyes.;
|
|
