ChemNet > CAS > 64-65-3 Bemegride
64-65-3 Bemegride
상품명칭 |
Bemegride |
별명 |
3-Ethyl-3-methylglutarimide; 4-Ethyl-4-methyl-2,6-piperidinedione; 3-Methyl-3-ethylglutarimide; 4-ethyl-4-methylpiperidine-2,6-dione |
분자식 |
C8H13NO2 |
분자량 |
155.1943 |
InChI |
InChI=1/C8H13NO2/c1-3-8(2)4-6(10)9-7(11)5-8/h3-5H2,1-2H3,(H,9,10,11) |
cas번호 |
64-65-3 |
EC번호 |
200-588-0 |
분자 구조 |
|
밀도 |
1.024g/cm3 |
녹는 점 |
126-129℃ |
비등점 |
282°C at 760 mmHg |
굴절 지수 |
1.448 |
인화점 |
125.8°C |
위험성 표시 |
T:Toxic;
|
리스크 규칙 |
R23/24/25:Toxic by inhalation, in contact with skin and if swallowed.;
|
보안 규칙 |
S24/25:Avoid contact with skin and eyes.;
|
|