ChemNet > CAS > 6435-75-2 4,5,6,7-tetrahydro-2-benzothiophene-1-carboxylic acid
6435-75-2 4,5,6,7-tetrahydro-2-benzothiophene-1-carboxylic acid
상품명칭 |
4,5,6,7-tetrahydro-2-benzothiophene-1-carboxylic acid |
별명 |
ethyl (2-chloro-6-ethoxy-4-formylphenoxy)acetate |
분자식 |
C13H15ClO5 |
분자량 |
286.7082 |
InChI |
InChI=1/C13H15ClO5/c1-3-17-11-6-9(7-15)5-10(14)13(11)19-8-12(16)18-4-2/h5-7H,3-4,8H2,1-2H3 |
cas번호 |
6435-75-2 |
분자 구조 |
|
밀도 |
1.243g/cm3 |
녹는 점 |
198℃ |
비등점 |
394.5°C at 760 mmHg |
굴절 지수 |
1.533 |
인화점 |
155.5°C |
위험성 표시 |
Xi:Irritant;
|
리스크 규칙 |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|