ChemNet > CAS > 64910-46-9 3-amino-4-(methylamino)benzonitrile
64910-46-9 3-amino-4-(methylamino)benzonitrile
상품명칭 |
3-amino-4-(methylamino)benzonitrile |
분자식 |
C8H9N3 |
분자량 |
147.1772 |
InChI |
InChI=1/C8H9N3/c1-11-8-3-2-6(5-9)4-7(8)10/h2-4,11H,10H2,1H3 |
cas번호 |
64910-46-9 |
분자 구조 |
|
밀도 |
1.155g/cm3 |
녹는 점 |
136℃ |
비등점 |
346.783°C at 760 mmHg |
굴절 지수 |
1.593 |
인화점 |
163.529°C |
위험성 표시 |
Xn:Harmful;
|
리스크 규칙 |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
보안 규칙 |
S36/37:Wear suitable protective clothing and gloves.;
|
|