ChemNet > CAS > 6575-09-3 2-Chloro-6-methylbenzonitrile
6575-09-3 2-Chloro-6-methylbenzonitrile
상품명칭 |
2-Chloro-6-methylbenzonitrile |
별명 |
6-Chloro-o-tolunitrile; 3-chloro-2-toluonitrile |
분자식 |
C8H6ClN |
분자량 |
151.5929 |
InChI |
InChI=1/C8H6ClN/c1-6-3-2-4-8(9)7(6)5-10/h2-4H,1H3 |
cas번호 |
6575-09-3 |
EC번호 |
229-499-5 |
분자 구조 |
|
밀도 |
1.19g/cm3 |
녹는 점 |
78-83℃ |
비등점 |
241.1°C at 760 mmHg |
굴절 지수 |
1.553 |
인화점 |
110.1°C |
위험성 표시 |
Xn:Harmful;
|
리스크 규칙 |
R20/21:Harmful by inhalation and in contact with skin.;
|
보안 규칙 |
S23:Do not inhale gas/fumes/vapour/spray.;
|
|