ChemNet > CAS > 6575-13-9 2,6-Dimethylbenzonitrile
6575-13-9 2,6-Dimethylbenzonitrile
상품명칭 |
2,6-Dimethylbenzonitrile |
별명 |
2,6-Dimethylbenzoniitrile |
분자식 |
C9H9N |
분자량 |
131.1745 |
InChI |
InChI=1/C9H9N/c1-7-4-3-5-8(2)9(7)6-10/h3-5H,1-2H3 |
cas번호 |
6575-13-9 |
EC번호 |
229-503-5 |
분자 구조 |
|
밀도 |
0.99g/cm3 |
녹는 점 |
87-89℃ |
비등점 |
228.7°C at 760 mmHg |
굴절 지수 |
1.525 |
인화점 |
91.9°C |
위험성 표시 |
Xn:Harmful;
|
리스크 규칙 |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
보안 규칙 |
S36/37:Wear suitable protective clothing and gloves.;
|
|