ChemNet > CAS > 65858-50-6 5-(bromomethyl)-2,1,3-benzothiadiazole
65858-50-6 5-(bromomethyl)-2,1,3-benzothiadiazole
상품명칭 |
5-(bromomethyl)-2,1,3-benzothiadiazole |
분자식 |
C7H5BrN2S |
분자량 |
229.097 |
InChI |
InChI=1/C7H5BrN2S/c8-4-5-1-2-6-7(3-5)10-11-9-6/h1-3H,4H2 |
cas번호 |
65858-50-6 |
분자 구조 |
|
밀도 |
1.776g/cm3 |
녹는 점 |
87℃ |
비등점 |
299.3°C at 760 mmHg |
굴절 지수 |
1.726 |
인화점 |
134.8°C |
위험성 표시 |
C:Corrosive;
|
리스크 규칙 |
R34:Causes burns.;
|
보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|