ChemNet > CAS > 659-30-3 4-fluorophenylurea
659-30-3 4-fluorophenylurea
상품명칭 |
4-fluorophenylurea |
별명 |
Urea, 1-(p-fluorophenyl)-; (4-Fluorophenyl)urea; 1-(p-Fluorophenyl)urea; 4-12-00-01108 (Beilstein Handbook Reference); BRN 2090131; 1-(4-fluorophenyl)urea; 1-(4-fluorophenyl)-1H-pyrrole |
분자식 |
C10H8FN |
분자량 |
161.1756 |
InChI |
InChI=1/C10H8FN/c11-9-3-5-10(6-4-9)12-7-1-2-8-12/h1-8H |
cas번호 |
659-30-3 |
분자 구조 |
|
밀도 |
1.07g/cm3 |
비등점 |
229.7°C at 760 mmHg |
굴절 지수 |
1.543 |
인화점 |
92.7°C |
위험성 표시 |
|
리스크 규칙 |
|
보안 규칙 |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|