ChemNet > CAS > 660425-16-1 2-Bromo-3,5-difluoropyridine
660425-16-1 2-Bromo-3,5-difluoropyridine
상품명칭 |
2-Bromo-3,5-difluoropyridine |
분자식 |
C5H2BrF2N |
분자량 |
193.97 |
InChI |
InChI=1/C5H2BrF2N/c6-5-4(8)1-3(7)2-9-5/h1-2H |
cas번호 |
660425-16-1 |
분자 구조 |
|
위험성 표시 |
|
리스크 규칙 |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|