ChemNet > CAS > 6638-05-7 2,6-Dimethoxy-4-methylphenol
6638-05-7 2,6-Dimethoxy-4-methylphenol
| 상품명칭 |
2,6-Dimethoxy-4-methylphenol |
| 별명 |
4-Methyl-2,6-dimethoxyphenol; 4-Hydroxy-3,5-dimethoxytoluene; 2,6-dimethoxy-4-methyl-phenol; 2,6-dimethoxy-p-cresol; 4-methylsyringol; 4-methylsyringol |
| 분자식 |
C9H12O3 |
| 분자량 |
168.1898 |
| InChI |
InChI=1/C9H12O3/c1-6-4-7(11-2)9(10)8(5-6)12-3/h4-5,10H,1-3H3 |
| cas번호 |
6638-05-7 |
| EC번호 |
229-641-6 |
| 분자 구조 |
|
| 밀도 |
1.105g/cm3 |
| 녹는 점 |
35-146℃ |
| 비등점 |
268.3°C at 760 mmHg |
| 굴절 지수 |
1.52 |
| 인화점 |
116.1°C |
| 위험성 표시 |
 Xi:Irritant;
|
| 리스크 규칙 |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| 보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|
