ChemNet > CAS > 66399-30-2 (S)-1-(4-Fluorophenyl)ethylamine
66399-30-2 (S)-1-(4-Fluorophenyl)ethylamine
상품명칭 |
(S)-1-(4-Fluorophenyl)ethylamine |
별명 |
(S)-(-)-1-(4-Fluorophenyl)ethylamine; (S)-4-Fluoro-alpha-methylbenzylamine; 1-bromo-2,3,4-trichloro-1,1,2-trifluorobutane; (1S)-1-(4-fluorophenyl)ethanamine |
분자식 |
C8H10FN |
분자량 |
139.1701 |
InChI |
InChI=1/C8H10FN/c1-6(10)7-2-4-8(9)5-3-7/h2-6H,10H2,1H3/t6-/m0/s1 |
cas번호 |
66399-30-2 |
분자 구조 |
|
밀도 |
1.063g/cm3 |
비등점 |
185.4°C at 760 mmHg |
굴절 지수 |
1.512 |
인화점 |
74°C |
위험성 표시 |
|
리스크 규칙 |
R34:Causes burns.;
|
보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|