ChemNet > CAS > 6781-42-6 1,3-Diacetylbenzene
6781-42-6 1,3-Diacetylbenzene
상품명칭 |
1,3-Diacetylbenzene |
별명 |
benzene-1,3-bis(acetyl); 1,1'-benzene-1,3-diyldiethanone; m-Diacetylbenzene |
분자식 |
C10H10O2 |
분자량 |
162.1852 |
InChI |
InChI=1/C10H10O2/c1-7(11)9-4-3-5-10(6-9)8(2)12/h3-6H,1-2H3 |
cas번호 |
6781-42-6 |
EC번호 |
229-842-9 |
분자 구조 |
|
밀도 |
1.063g/cm3 |
녹는 점 |
35-37℃ |
비등점 |
280.3°C at 760 mmHg |
굴절 지수 |
1.519 |
인화점 |
108.5°C |
위험성 표시 |
|
리스크 규칙 |
|
보안 규칙 |
S24/25:Avoid contact with skin and eyes.;
|
|