ChemNet > CAS > 68282-47-3 2-phenyl-1H-imidazole-4-carbaldehyde
68282-47-3 2-phenyl-1H-imidazole-4-carbaldehyde
상품명칭 |
2-phenyl-1H-imidazole-4-carbaldehyde |
별명 |
2-phenyl-1H-imidazole-5-carbaldehyde |
분자식 |
C10H8N2O |
분자량 |
172.1833 |
InChI |
InChI=1/C10H8N2O/c13-7-9-6-11-10(12-9)8-4-2-1-3-5-8/h1-7H,(H,11,12) |
cas번호 |
68282-47-3 |
분자 구조 |
|
밀도 |
1.248g/cm3 |
녹는 점 |
167℃ |
비등점 |
418.9°C at 760 mmHg |
굴절 지수 |
1.646 |
인화점 |
208.7°C |
위험성 표시 |
Xn:Harmful;
|
리스크 규칙 |
R21/22:Harmful in contact with skin and if swallowed.;
|
보안 규칙 |
S36/37:Wear suitable protective clothing and gloves.;
|
|