ChemNet > CAS > 68385-95-5 2-Amino-3,5-dibromobenzonitrile
68385-95-5 2-Amino-3,5-dibromobenzonitrile
| 상품명칭 |
2-Amino-3,5-dibromobenzonitrile |
| 분자식 |
C7H4Br2N2 |
| 분자량 |
275.9281 |
| InChI |
InChI=1/C7H4Br2N2/c8-5-1-4(3-10)7(11)6(9)2-5/h1-2H,11H2 |
| cas번호 |
68385-95-5 |
| 분자 구조 |
|
| 밀도 |
2.12g/cm3 |
| 녹는 점 |
160-163℃ |
| 비등점 |
301.2°C at 760 mmHg |
| 굴절 지수 |
1.704 |
| 인화점 |
136°C |
| 위험성 표시 |
 Xn:Harmful;
|
| 리스크 규칙 |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| 보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
|
|
