ChemNet > CAS > 68412-48-6 2-Propanone, reaction products with diphenylamine
68412-48-6 2-Propanone, reaction products with diphenylamine
| 상품명칭 |
2-Propanone, reaction products with diphenylamine |
| 별명 |
Acetone diphenylamine condensation products; Acetone, diphenylamine condensation product; Diphenylamine, acetone reaction product; N-Phenylbenzeneamine, 2-propanone reaction product; propan-2-one-N-cyclohexylcyclohexanamine (1:1); propan-2-one-N-phenylaniline (1:1); Acetone Diphenylamine; Antioxidant BLE; Rubber Antioxidant BLE-W |
| 분자식 |
C15H17NO |
| 분자량 |
227.3016 |
| InChI |
InChI=1/C12H11N.C3H6O/c1-3-7-11(8-4-1)13-12-9-5-2-6-10-12;1-3(2)4/h1-10,13H;1-2H3 |
| cas번호 |
68412-48-6 |
| EC번호 |
270-192-0 |
| 분자 구조 |
|
| 비등점 |
302°C at 760 mmHg |
| 인화점 |
152.8°C |
| 위험성 표시 |
|
| 리스크 규칙 |
|
| 보안 규칙 |
|
|
