ChemNet > CAS > 68909-80-8 Isoquinoline, reaction products with benzyl chloride and quinoline
68909-80-8 Isoquinoline, reaction products with benzyl chloride and quinoline
상품명칭 |
Isoquinoline, reaction products with benzyl chloride and quinoline |
별명 |
chloromethylbenzene; isoquinoline; quinoline |
분자식 |
C25H21ClN2 |
분자량 |
384.9006 |
InChI |
InChI=1/2C9H7N.C7H7Cl/c1-2-6-9-8(4-1)5-3-7-10-9;1-2-4-9-7-10-6-5-8(9)3-1;8-6-7-4-2-1-3-5-7/h2*1-7H;1-5H,6H2 |
cas번호 |
68909-80-8 |
EC번호 |
272-714-2 |
분자 구조 |
|
비등점 |
234.1°C at 760 mmHg |
인화점 |
101.1°C |
위험성 표시 |
|
리스크 규칙 |
|
보안 규칙 |
|
|