ChemNet > CAS > 696-82-2 2,4,6-trifluoropyrimidine
696-82-2 2,4,6-trifluoropyrimidine
상품명칭 |
2,4,6-trifluoropyrimidine |
별명 |
2,4,6-Trifluoropyrimidine |
분자식 |
C4HF3N2 |
분자량 |
134.0593 |
InChI |
InChI=1/C4HF3N2/c5-2-1-3(6)9-4(7)8-2/h1H |
cas번호 |
696-82-2 |
EC번호 |
211-801-1 |
분자 구조 |
|
밀도 |
1.514g/cm3 |
비등점 |
195.6°C at 760 mmHg |
굴절 지수 |
1.42 |
인화점 |
72.1°C |
위험성 표시 |
|
리스크 규칙 |
R34:Causes burns.;
R37:Irritating to respiratory system.;
|
보안 규칙 |
S23:Do not inhale gas/fumes/vapour/spray.;
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|