ChemNet > CAS > 6967-29-9 2-Chloro-N-(2,6-diethylphenyl)-acetamide
6967-29-9 2-Chloro-N-(2,6-diethylphenyl)-acetamide
상품명칭 |
2-Chloro-N-(2,6-diethylphenyl)-acetamide |
별명 |
N-Chloroacetyl-2,6-diethylaniline; alpha-Chloro-2,6-diethylacetanilide |
분자식 |
C12H16ClNO |
분자량 |
225.7145 |
InChI |
InChI=1/C12H16ClNO/c1-3-9-6-5-7-10(4-2)12(9)14-11(15)8-13/h5-7H,3-4,8H2,1-2H3,(H,14,15) |
cas번호 |
6967-29-9 |
분자 구조 |
|
밀도 |
1.131g/cm3 |
비등점 |
369.2°C at 760 mmHg |
굴절 지수 |
1.559 |
인화점 |
177.1°C |
위험성 표시 |
|
리스크 규칙 |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|