ChemNet > CAS > 698-90-8 cyclohexylurea
698-90-8 cyclohexylurea
상품명칭 |
cyclohexylurea |
별명 |
N-CYCLOHEXLUREA; 1-Cyclohexylurea; N-Cyclohexylurea; Cyclohexyl-ure |
분자식 |
C7H14N2O |
분자량 |
142.1989 |
InChI |
InChI=1/C7H14N2O/c8-7(10)9-6-4-2-1-3-5-6/h6H,1-5H2,(H3,8,9,10) |
cas번호 |
698-90-8 |
EC번호 |
211-822-6 |
분자 구조 |
|
밀도 |
1.05g/cm3 |
비등점 |
240.3°C at 760 mmHg |
굴절 지수 |
1.5 |
인화점 |
99.2°C |
위험성 표시 |
|
리스크 규칙 |
|
보안 규칙 |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|