ChemNet > CAS > 703-23-1 2-Hydroxy-6-methoxyacetophenone
703-23-1 2-Hydroxy-6-methoxyacetophenone
상품명칭 |
2-Hydroxy-6-methoxyacetophenone |
별명 |
1-(2-Hydroxy-6-methoxyphenyl)ethan-1-one; 1-(2-hydroxy-6-methoxyphenyl)ethanone; 2'-Hydroxy-6'-methoxyacetophenone |
분자식 |
C9H10O3 |
분자량 |
166.1739 |
InChI |
InChI=1/C9H10O3/c1-6(10)9-7(11)4-3-5-8(9)12-2/h3-5,11H,1-2H3 |
cas번호 |
703-23-1 |
EC번호 |
211-872-9 |
분자 구조 |
|
밀도 |
1.158g/cm3 |
녹는 점 |
58-60℃ |
비등점 |
259.5°C at 760 mmHg |
굴절 지수 |
1.537 |
인화점 |
108.1°C |
위험성 표시 |
|
리스크 규칙 |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|