ChemNet > CAS > 7145-99-5 3,4-(Methylenedioxy)toluene
7145-99-5 3,4-(Methylenedioxy)toluene
상품명칭 |
3,4-(Methylenedioxy)toluene |
별명 |
5-Methyl-1,3-benzodioxole~1-Methyl-3,4-(methylenedioxy)benzene; 5-methyl-1,3-benzodioxole |
분자식 |
C8H8O2 |
분자량 |
136.1479 |
InChI |
InChI=1/C8H8O2/c1-6-2-3-7-8(4-6)10-5-9-7/h2-4H,5H2,1H3 |
cas번호 |
7145-99-5 |
EC번호 |
230-453-1 |
분자 구조 |
|
밀도 |
1.164g/cm3 |
비등점 |
200.4°C at 760 mmHg |
굴절 지수 |
1.55 |
인화점 |
76.1°C |
위험성 표시 |
|
리스크 규칙 |
|
보안 규칙 |
S23:Do not inhale gas/fumes/vapour/spray.;
S24/25:Avoid contact with skin and eyes.;
|
|